#!/usr/bin/env tsx /** * Stress Test Database Population Script * * This script populates the Trilium database with a large number of diverse notes * for performance testing, search testing, and stress testing purposes. * * Usage: * pnpm tsx scripts/stress-test-populate.ts [options] * * Options: * --notes=N Number of notes to create (default: 5000) * --depth=N Maximum hierarchy depth (default: 10) * --max-relations=N Maximum relations per note (default: 10) * --max-labels=N Maximum labels per note (default: 8) * --help Show this help message * * Note: This script requires an existing Trilium database. Run Trilium at least once * before running this script to initialize the database. */ // Set up environment variables like the server does process.env.TRILIUM_ENV = "dev"; process.env.TRILIUM_DATA_DIR = process.env.TRILIUM_DATA_DIR || "trilium-data"; import { initializeTranslations } from "../apps/server/src/services/i18n.js"; import BNote from "../apps/server/src/becca/entities/bnote.js"; import BBranch from "../apps/server/src/becca/entities/bbranch.js"; import BAttribute from "../apps/server/src/becca/entities/battribute.js"; import becca from "../apps/server/src/becca/becca.js"; import { NoteBuilder, id, note } from "../apps/server/src/test/becca_mocking.js"; import type { NoteType } from "@triliumnext/commons"; // Parse command line arguments const args = process.argv.slice(2); const config = { noteCount: 5000, maxDepth: 10, maxRelations: 10, maxLabels: 8, }; for (const arg of args) { if (arg === "--help" || arg === "-h") { console.log(` Stress Test Database Population Script This script populates the Trilium database with a large number of diverse notes for performance testing, search testing, and stress testing purposes. Usage: pnpm tsx scripts/stress-test-populate.ts [options] Options: --notes=N Number of notes to create (default: ${config.noteCount}) --depth=N Maximum hierarchy depth (default: ${config.maxDepth}) --max-relations=N Maximum relations per note (default: ${config.maxRelations}) --max-labels=N Maximum labels per note (default: ${config.maxLabels}) --help, -h Show this help message Examples: # Use defaults (5000 notes, depth 10) pnpm tsx scripts/stress-test-populate.ts # Create 10000 notes with depth 15 pnpm tsx scripts/stress-test-populate.ts --notes=10000 --depth=15 # Smaller test with 1000 notes and depth 5 pnpm tsx scripts/stress-test-populate.ts --notes=1000 --depth=5 `); process.exit(0); } const match = arg.match(/--(\w+)=(.+)/); if (match) { const [, key, value] = match; switch (key) { case "notes": config.noteCount = parseInt(value, 10); break; case "depth": config.maxDepth = parseInt(value, 10); break; case "max-relations": config.maxRelations = parseInt(value, 10); break; case "max-labels": config.maxLabels = parseInt(value, 10); break; } } } console.log("Stress Test Database Population"); console.log("================================"); console.log(`Target note count: ${config.noteCount}`); console.log(`Maximum depth: ${config.maxDepth}`); console.log(`Maximum relations per note: ${config.maxRelations}`); console.log(`Maximum labels per note: ${config.maxLabels}`); console.log(""); // Note type distribution (rough percentages) const NOTE_TYPES: { type: NoteType; mime: string; weight: number }[] = [ { type: "text", mime: "text/html", weight: 50 }, { type: "code", mime: "text/javascript", weight: 15 }, { type: "code", mime: "text/x-python", weight: 10 }, { type: "code", mime: "application/json", weight: 5 }, { type: "mermaid", mime: "text/mermaid", weight: 5 }, { type: "book", mime: "text/html", weight: 5 }, { type: "render", mime: "text/html", weight: 3 }, { type: "relationMap", mime: "application/json", weight: 2 }, { type: "search", mime: "application/json", weight: 2 }, { type: "canvas", mime: "application/json", weight: 2 }, { type: "doc", mime: "text/html", weight: 1 }, ]; // Sample content generators const LOREM_IPSUM = `Lorem ipsum dolor sit amet, consectetur adipiscing elit. Sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris.`; const CODE_SAMPLES = { "text/javascript": `function fibonacci(n) { if (n <= 1) return n; return fibonacci(n - 1) + fibonacci(n - 2); } console.log(fibonacci(10));`, "text/x-python": `def quicksort(arr): if len(arr) <= 1: return arr pivot = arr[len(arr) // 2] left = [x for x in arr if x < pivot] middle = [x for x in arr if x == pivot] right = [x for x in arr if x > pivot] return quicksort(left) + middle + quicksort(right) print(quicksort([3, 6, 8, 10, 1, 2, 1]))`, "application/json": `{ "name": "example", "version": "1.0.0", "description": "A sample JSON document", "keywords": ["example", "test", "stress"] }`, }; const MERMAID_SAMPLE = `graph TD A[Start] --> B{Decision} B -->|Yes| C[Process] B -->|No| D[Alternative] C --> E[End] D --> E`; // Common label names and value patterns const LABEL_NAMES = [ "priority", "status", "category", "tag", "project", "version", "author", "reviewed", "archived", "published", "draft", "language", "framework", "difficulty", "rating", "year", "month", "country", "city", "department" ]; const LABEL_VALUES = { priority: ["high", "medium", "low", "critical"], status: ["active", "completed", "pending", "archived", "draft"], category: ["personal", "work", "reference", "project", "research"], rating: ["1", "2", "3", "4", "5"], difficulty: ["beginner", "intermediate", "advanced", "expert"], language: ["javascript", "python", "typescript", "rust", "go", "java"], framework: ["react", "vue", "angular", "express", "django", "flask"], }; // Relation names const RELATION_NAMES = [ "relatedTo", "dependsOn", "references", "implements", "extends", "baseOn", "contains", "partOf", "author", "reviewer", "assignedTo", "linkedWith", "similarTo", "contradicts", "supports" ]; // Title prefixes for different categories const TITLE_PREFIXES = [ "Documentation", "Tutorial", "Guide", "Reference", "API", "Concept", "Example", "Pattern", "Architecture", "Design", "Implementation", "Analysis", "Research", "Note", "Idea", "Project", "Task", "Feature", "Bug", "Issue", "Discussion", "Meeting", "Review", "Proposal", "Spec" ]; const TITLE_SUBJECTS = [ "Authentication", "Database", "API", "Frontend", "Backend", "Security", "Performance", "Testing", "Deployment", "Configuration", "Monitoring", "Logging", "Caching", "Scaling", "Optimization", "Refactoring", "Integration", "Migration", "Upgrade", "Architecture", "Infrastructure" ]; /** * Select a random item from array based on weights */ function weightedRandom(items: T[]): T { const totalWeight = items.reduce((sum, item) => sum + item.weight, 0); let random = Math.random() * totalWeight; for (const item of items) { random -= item.weight; if (random <= 0) { return item; } } return items[items.length - 1]; } /** * Generate random integer between min and max (inclusive) */ function randomInt(min: number, max: number): number { return Math.floor(Math.random() * (max - min + 1)) + min; } /** * Generate a random title */ function generateTitle(index: number): string { if (Math.random() < 0.3) { // Use structured title const prefix = TITLE_PREFIXES[randomInt(0, TITLE_PREFIXES.length - 1)]; const subject = TITLE_SUBJECTS[randomInt(0, TITLE_SUBJECTS.length - 1)]; return `${prefix}: ${subject} #${index}`; } else { // Use simple title return `Note ${index}`; } } /** * Generate content based on note type */ function generateContent(type: NoteType, mime: string): string { if (type === "code" && CODE_SAMPLES[mime as keyof typeof CODE_SAMPLES]) { return CODE_SAMPLES[mime as keyof typeof CODE_SAMPLES]; } else if (type === "mermaid") { return MERMAID_SAMPLE; } else if (type === "text" || type === "book" || type === "doc") { // Generate multiple paragraphs const paragraphs = randomInt(1, 5); return Array(paragraphs).fill(LOREM_IPSUM).join("\n\n"); } else if (mime === "application/json") { return CODE_SAMPLES["application/json"]; } return ""; } /** * Generate random labels for a note */ function generateLabels(noteBuilder: NoteBuilder, count: number): void { const labelsToAdd = Math.min(count, randomInt(0, config.maxLabels)); for (let i = 0; i < labelsToAdd; i++) { const labelName = LABEL_NAMES[randomInt(0, LABEL_NAMES.length - 1)]; let labelValue = ""; // Use predefined values if available if (LABEL_VALUES[labelName as keyof typeof LABEL_VALUES]) { const values = LABEL_VALUES[labelName as keyof typeof LABEL_VALUES]; labelValue = values[randomInt(0, values.length - 1)]; } else { labelValue = `value${randomInt(1, 100)}`; } const isInheritable = Math.random() < 0.2; // 20% chance of inheritable noteBuilder.label(labelName, labelValue, isInheritable); } } /** * Generate random relations for a note */ function generateRelations( noteBuilder: NoteBuilder, allNotes: BNote[], maxRelations: number ): void { if (allNotes.length === 0) return; const relationsToAdd = Math.min( maxRelations, randomInt(0, config.maxRelations) ); for (let i = 0; i < relationsToAdd; i++) { const relationName = RELATION_NAMES[randomInt(0, RELATION_NAMES.length - 1)]; const targetNote = allNotes[randomInt(0, allNotes.length - 1)]; // Avoid self-relations if (targetNote.noteId !== noteBuilder.note.noteId) { noteBuilder.relation(relationName, targetNote); } } } /** * Create a note with random attributes */ function createRandomNote( index: number, allNotes: BNote[] ): NoteBuilder { const noteType = weightedRandom(NOTE_TYPES); const title = generateTitle(index); const noteBuilder = note(title, { noteId: id(), type: noteType.type, mime: noteType.mime, }); // Set content const content = generateContent(noteType.type, noteType.mime); if (content) { noteBuilder.note.setContent(content, { forceSave: true }); } // Add labels generateLabels(noteBuilder, randomInt(0, config.maxLabels)); // Add relations (limit based on available notes) const maxPossibleRelations = Math.min( config.maxRelations, Math.floor(allNotes.length / 10) // Limit to avoid too dense graphs ); generateRelations(noteBuilder, allNotes, maxPossibleRelations); // 5% chance of protected note if (Math.random() < 0.05) { noteBuilder.note.isProtected = true; } // 10% chance of archived note if (Math.random() < 0.1) { noteBuilder.label("archived", "", true); } return noteBuilder; } /** * Create notes recursively to build hierarchy */ function createNotesRecursively( parent: NoteBuilder, depth: number, targetCount: number, allNotes: BNote[] ): number { let created = 0; if (depth >= config.maxDepth || targetCount <= 0) { return 0; } // Determine how many children at this level // Decrease children count as depth increases to create pyramid structure const maxChildrenAtDepth = Math.max(1, Math.floor(20 / (depth + 1))); const childrenCount = Math.min( targetCount, randomInt(1, maxChildrenAtDepth) ); for (let i = 0; i < childrenCount && created < targetCount; i++) { const noteBuilder = createRandomNote(allNotes.length + 1, allNotes); parent.child(noteBuilder); allNotes.push(noteBuilder.note); created++; // Log progress every 100 notes if (allNotes.length % 100 === 0) { console.log(` Created ${allNotes.length} notes...`); } // Recursively create children const remainingForSubtree = Math.floor((targetCount - created) / (childrenCount - i)); const createdInSubtree = createNotesRecursively( noteBuilder, depth + 1, remainingForSubtree, allNotes ); created += createdInSubtree; } return created; } /** * Main execution */ async function main() { console.log("Initializing translations..."); await initializeTranslations(); console.log("Loading becca (backend cache)..."); // Directly load becca instead of waiting for beccaLoaded promise // (beccaLoaded depends on dbReady which won't resolve in this script context) const becca_loader = (await import("../apps/server/src/becca/becca_loader.js")).default; const cls = (await import("../apps/server/src/services/cls.js")).default; // Load becca and run the population inside CLS context cls.init(() => { becca_loader.load(); console.log("Becca loaded successfully."); populateNotes(); }); } function populateNotes() { const rootNote = becca.getNote("root"); if (!rootNote) { throw new Error("Root note not found!"); } // Create a container note for all stress test notes const containerNote = note("Stress Test Notes", { noteId: id(), type: "book", mime: "text/html", }); containerNote.note.setContent( `

This note contains ${config.noteCount} notes generated for stress testing.

` + `

Generated on: ${new Date().toISOString()}

` + `

Configuration: depth=${config.maxDepth}, maxRelations=${config.maxRelations}, maxLabels=${config.maxLabels}

`, { forceSave: true } ); const rootBuilder = new NoteBuilder(rootNote); rootBuilder.child(containerNote); console.log("\nCreating notes..."); const startTime = Date.now(); const allNotes: BNote[] = [containerNote.note]; // Create notes recursively const created = createNotesRecursively( containerNote, 0, config.noteCount - 1, // -1 because we already created container allNotes ); const endTime = Date.now(); const duration = (endTime - startTime) / 1000; console.log("\n================================"); console.log("Stress Test Population Complete!"); console.log("================================"); console.log(`Total notes created: ${allNotes.length}`); console.log(`Time taken: ${duration.toFixed(2)} seconds`); console.log(`Notes per second: ${(allNotes.length / duration).toFixed(2)}`); console.log(`Container note ID: ${containerNote.note.noteId}`); console.log(""); // Print statistics const noteTypeCount: Record = {}; const labelCount: Record = {}; let totalRelations = 0; let protectedCount = 0; let archivedCount = 0; for (const note of allNotes) { // Count note types noteTypeCount[note.type] = (noteTypeCount[note.type] || 0) + 1; // Count labels for (const attr of note.getOwnedAttributes()) { if (attr.type === "label") { labelCount[attr.name] = (labelCount[attr.name] || 0) + 1; if (attr.name === "archived") archivedCount++; } else if (attr.type === "relation") { totalRelations++; } } if (note.isProtected) protectedCount++; } console.log("Note Type Distribution:"); for (const [type, count] of Object.entries(noteTypeCount).sort((a, b) => b[1] - a[1])) { console.log(` ${type}: ${count}`); } console.log("\nTop 10 Label Names:"); const sortedLabels = Object.entries(labelCount) .sort((a, b) => b[1] - a[1]) .slice(0, 10); for (const [name, count] of sortedLabels) { console.log(` ${name}: ${count}`); } console.log("\nOther Statistics:"); console.log(` Total relations: ${totalRelations}`); console.log(` Protected notes: ${protectedCount}`); console.log(` Archived notes: ${archivedCount}`); console.log(""); console.log("You can find all generated notes under the 'Stress Test Notes' note in the tree."); } // Run the script main().catch((error) => { console.error("Error during stress test population:"); console.error(error); process.exit(1); });